C16H26N2 — CID 137446784
N'-[(1Z,4Z)-4-tert-butyl-3-methylidenehexa-1,4-dienyl]-2-methylbut-3-enimidamide (PubChem CID 137446784) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N'-[(1Z,4Z)-4-tert-butyl-3-methylidenehexa-1,4-dienyl]-2-methylbut-3-enimidamide.
| Compound Name | N'-[(1Z,4Z)-4-tert-butyl-3-methylidenehexa-1,4-dienyl]-2-methylbut-3-enimidamide |
|---|---|
| PubChem CID | 137446784 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N'-[(1Z,4Z)-4-tert-butyl-3-methylidenehexa-1,4-dienyl]-2-methylbut-3-enimidamide |
| SMILES | C=CC(C)/C(N)=N/C=C\C(=C)/C(=C\C)C(C)(C)C |
| InChI | InChI=1S/C16H26N2/c1-8-12(3)15(17)18-11-10-13(4)14(9-2)16(5,6)7/h8-12H,1,4H2,2-3,5-7H3,(H2,17,18)/b11-10-,14-9+ |
| InChIKey | FGOAGBBCBRAGPS-YYUCOLILSA-N |
| XLogP | 4.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|