About [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine
[(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine (PubChem CID 137447232) has the molecular formula C7H16N2S
and a molecular weight of 160.29 g/mol. Its IUPAC name is [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine |
| PubChem CID | 137447232 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine |
| SMILES | CSC[C@@H]1C[C@@H](CN)CN1 |
| InChI | InChI=1S/C7H16N2S/c1-10-5-7-2-6(3-8)4-9-7/h6-7,9H,2-5,8H2,1H3/t6-,7-/m0/s1 |
| InChIKey | XQFTTXPWTGPJAM-BQBZGAKWSA-N |
| XLogP | 0.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine?
The IUPAC name of [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine (CID 137447232) is [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine.
What is the SMILES notation for [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine?
The canonical SMILES for [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine is CSC[C@@H]1C[C@@H](CN)CN1.
What is the InChIKey of [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine?
The InChIKey is XQFTTXPWTGPJAM-BQBZGAKWSA-N. The full InChI is InChI=1S/C7H16N2S/c1-10-5-7-2-6(3-8)4-9-7/h6-7,9H,2-5,8H2,1H3/t6-,7-/m0/s1.
What are the key properties of [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine?
[(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine has a molecular weight of 160.29 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-5-(methylsulfanylmethyl)pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 137447232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).