C24H39FO3 — CID 137448023
6-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3-dimethoxy-5-methylcyclohex-2-en-1-ol (PubChem CID 137448023) has the molecular formula C24H39FO3 and a molecular weight of 394.57 g/mol. Its IUPAC name is 6-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3-dimethoxy-5-methylcyclohex-2-en-1-ol.
| Compound Name | 6-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3-dimethoxy-5-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 137448023 |
| Molecular Formula | C24H39FO3 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 6-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-2,3-dimethoxy-5-methylcyclohex-2-en-1-ol |
| SMILES | COC1=C(OC)C(O)C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CF)C(C)C1 |
| InChI | InChI=1S/C24H39FO3/c1-17(10-8-12-19(3)16-25)9-7-11-18(2)13-14-21-20(4)15-22(27-5)24(28-6)23(21)26/h9,12-13,20-21,23,26H,7-8,10-11,14-16H2,1-6H3/b17-9+,18-13+,19-12+ |
| InChIKey | XEGMFWPDWFFHOZ-FFGSEWCMSA-N |
| XLogP | 6.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|