C9H18N4 — CID 137448248
1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-N-methylmethanamine (PubChem CID 137448248) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-N-methylmethanamine.
| Compound Name | 1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 137448248 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-N-methylmethanamine |
| SMILES | CNCN1CCCN2CCCN=C21 |
| InChI | InChI=1S/C9H18N4/c1-10-8-13-7-3-6-12-5-2-4-11-9(12)13/h10H,2-8H2,1H3 |
| InChIKey | QCOQSUZHILYPFK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |