C25H25ClN2O6 — CID 137448321
ethanimidoyl 4-[2-[5-(4-chloro-3,5-dimethoxyphenyl)furan-2-yl]-1-ethoxy-2-oxoethyl]benzenecarboximidate (PubChem CID 137448321) has the molecular formula C25H25ClN2O6 and a molecular weight of 484.94 g/mol. Its IUPAC name is ethanimidoyl 4-[2-[5-(4-chloro-3,5-dimethoxyphenyl)furan-2-yl]-1-ethoxy-2-oxoethyl]benzenecarboximidate.
| Compound Name | ethanimidoyl 4-[2-[5-(4-chloro-3,5-dimethoxyphenyl)furan-2-yl]-1-ethoxy-2-oxoethyl]benzenecarboximidate |
|---|---|
| PubChem CID | 137448321 |
| Molecular Formula | C25H25ClN2O6 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | ethanimidoyl 4-[2-[5-(4-chloro-3,5-dimethoxyphenyl)furan-2-yl]-1-ethoxy-2-oxoethyl]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1ccc(C(OCC)C(=O)c2ccc(-c3cc(OC)c(Cl)c(OC)c3)o2)cc1 |
| InChI | InChI=1S/C25H25ClN2O6/c1-5-32-24(15-6-8-16(9-7-15)25(28)33-14(2)27)23(29)19-11-10-18(34-19)17-12-20(30-3)22(26)21(13-17)31-4/h6-13,24,27-28H,5H2,1-4H3/b27-14+,28-25- |
| InChIKey | QXLCXHUDSRLEJG-CJVXNKBJSA-N |
| XLogP | 5.92 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|