C12H24N2 — CID 137448351
1-(5-methylhexyl)-4,5,6,7-tetrahydro-1,3-diazepine (PubChem CID 137448351) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-(5-methylhexyl)-4,5,6,7-tetrahydro-1,3-diazepine.
| Compound Name | 1-(5-methylhexyl)-4,5,6,7-tetrahydro-1,3-diazepine |
|---|---|
| PubChem CID | 137448351 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-(5-methylhexyl)-4,5,6,7-tetrahydro-1,3-diazepine |
| SMILES | CC(C)CCCCN1C=NCCCC1 |
| InChI | InChI=1S/C12H24N2/c1-12(2)7-3-5-9-14-10-6-4-8-13-11-14/h11-12H,3-10H2,1-2H3 |
| InChIKey | INRILQMPATUQJQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|