C33H22Cl2 — CID 137448750
2-chloro-5-(4-chlorophenyl)-2',7'-dimethyl-9,9'-spirobi[fluorene] (PubChem CID 137448750) has the molecular formula C33H22Cl2 and a molecular weight of 489.45 g/mol. Its IUPAC name is 2-chloro-5-(4-chlorophenyl)-2',7'-dimethyl-9,9'-spirobi[fluorene].
| Compound Name | 2-chloro-5-(4-chlorophenyl)-2',7'-dimethyl-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 137448750 |
| Molecular Formula | C33H22Cl2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-chloro-5-(4-chlorophenyl)-2',7'-dimethyl-9,9'-spirobi[fluorene] |
| SMILES | Cc1ccc2c(c1)C1(c3cc(C)ccc3-2)c2cc(Cl)ccc2-c2c(-c3ccc(Cl)cc3)cccc21 |
| InChI | InChI=1S/C33H22Cl2/c1-19-6-13-25-26-14-7-20(2)17-30(26)33(29(25)16-19)28-5-3-4-24(21-8-10-22(34)11-9-21)32(28)27-15-12-23(35)18-31(27)33/h3-18H,1-2H3 |
| InChIKey | CMKXJRKPQLQUHS-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |