About 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one
1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one (PubChem CID 137449496) has the molecular formula C12H17F2N3O
and a molecular weight of 257.28 g/mol. Its IUPAC name is 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one |
| PubChem CID | 137449496 |
| Molecular Formula | C12H17F2N3O |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one |
| SMILES | CNc1cccn([C@H]2CCN(C)CC2(F)F)c1=O |
| InChI | InChI=1S/C12H17F2N3O/c1-15-9-4-3-6-17(11(9)18)10-5-7-16(2)8-12(10,13)14/h3-4,6,10,15H,5,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | NZRMHWHDYZZULQ-JTQLQIEISA-N |
| XLogP | 1.40 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one?
The IUPAC name of 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one (CID 137449496) is 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one.
What is the SMILES notation for 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one?
The canonical SMILES for 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one is CNc1cccn([C@H]2CCN(C)CC2(F)F)c1=O.
What is the InChIKey of 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one?
The InChIKey is NZRMHWHDYZZULQ-JTQLQIEISA-N. The full InChI is InChI=1S/C12H17F2N3O/c1-15-9-4-3-6-17(11(9)18)10-5-7-16(2)8-12(10,13)14/h3-4,6,10,15H,5,7-8H2,1-2H3/t10-/m0/s1.
What are the key properties of 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one?
1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one has a molecular weight of 257.28 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(methylamino)pyridin-2-one is sourced from PubChem (CID 137449496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).