C17H15F3N6O — CID 137449530
N-cyclopropyl-7-(methylamino)-5-(2,3,5-trifluoroanilino)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 137449530) has the molecular formula C17H15F3N6O and a molecular weight of 376.34 g/mol. Its IUPAC name is N-cyclopropyl-7-(methylamino)-5-(2,3,5-trifluoroanilino)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-cyclopropyl-7-(methylamino)-5-(2,3,5-trifluoroanilino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 137449530 |
| Molecular Formula | C17H15F3N6O |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-cyclopropyl-7-(methylamino)-5-(2,3,5-trifluoroanilino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CNc1cc(Nc2cc(F)cc(F)c2F)nc2c(C(=O)NC3CC3)cnn12 |
| InChI | InChI=1S/C17H15F3N6O/c1-21-14-6-13(24-12-5-8(18)4-11(19)15(12)20)25-16-10(7-22-26(14)16)17(27)23-9-2-3-9/h4-7,9,21H,2-3H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | AZNHZBSVCNSRHG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|