C17H23N3 — CID 137450494
(1Z,7Z)-N-methyl-3,6-dimethylidene-1-(5-methylpyrazol-1-yl)deca-1,7,9-trien-1-amine (PubChem CID 137450494) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is (1Z,7Z)-N-methyl-3,6-dimethylidene-1-(5-methylpyrazol-1-yl)deca-1,7,9-trien-1-amine.
| Compound Name | (1Z,7Z)-N-methyl-3,6-dimethylidene-1-(5-methylpyrazol-1-yl)deca-1,7,9-trien-1-amine |
|---|---|
| PubChem CID | 137450494 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | (1Z,7Z)-N-methyl-3,6-dimethylidene-1-(5-methylpyrazol-1-yl)deca-1,7,9-trien-1-amine |
| SMILES | C=C/C=C\C(=C)CCC(=C)/C=C(/NC)n1nccc1C |
| InChI | InChI=1S/C17H23N3/c1-6-7-8-14(2)9-10-15(3)13-17(18-5)20-16(4)11-12-19-20/h6-8,11-13,18H,1-3,9-10H2,4-5H3/b8-7-,17-13- |
| InChIKey | TZRFLWYOZBSOEU-YTALYMLMSA-N |
| XLogP | 3.84 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|