C18H28FN3O3 — CID 137450623
2-methylbutan-2-yl N-[1-[1-(2-fluoroethyl)piperidin-3-yl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 137450623) has the molecular formula C18H28FN3O3 and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-methylbutan-2-yl N-[1-[1-(2-fluoroethyl)piperidin-3-yl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | 2-methylbutan-2-yl N-[1-[1-(2-fluoroethyl)piperidin-3-yl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 137450623 |
| Molecular Formula | C18H28FN3O3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-methylbutan-2-yl N-[1-[1-(2-fluoroethyl)piperidin-3-yl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | CCC(C)(C)OC(=O)Nc1cccn(C2CCCN(CCF)C2)c1=O |
| InChI | InChI=1S/C18H28FN3O3/c1-4-18(2,3)25-17(24)20-15-8-6-11-22(16(15)23)14-7-5-10-21(13-14)12-9-19/h6,8,11,14H,4-5,7,9-10,12-13H2,1-3H3,(H,20,24) |
| InChIKey | FMNKIJIFSVWXPP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |