About 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one
3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one (PubChem CID 137450777) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one.
Molecular Properties
| Compound Name | 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one |
| PubChem CID | 137450777 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one |
| SMILES | Nc1cccn([C@H]2CCC[C@H](O)C2)c1=O |
| InChI | InChI=1S/C11H16N2O2/c12-10-5-2-6-13(11(10)15)8-3-1-4-9(14)7-8/h2,5-6,8-9,14H,1,3-4,7,12H2/t8-,9-/m0/s1 |
| InChIKey | HALIPTNEYGGPJK-IUCAKERBSA-N |
| XLogP | 0.91 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one?
The IUPAC name of 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one (CID 137450777) is 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one.
What is the SMILES notation for 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one?
The canonical SMILES for 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one is Nc1cccn([C@H]2CCC[C@H](O)C2)c1=O.
What is the InChIKey of 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one?
The InChIKey is HALIPTNEYGGPJK-IUCAKERBSA-N. The full InChI is InChI=1S/C11H16N2O2/c12-10-5-2-6-13(11(10)15)8-3-1-4-9(14)7-8/h2,5-6,8-9,14H,1,3-4,7,12H2/t8-,9-/m0/s1.
What are the key properties of 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one?
3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one has a molecular weight of 208.26 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[(1S,3S)-3-hydroxycyclohexyl]pyridin-2-one is sourced from PubChem (CID 137450777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).