About 4-sulfanylpiperidin-4-ol
4-sulfanylpiperidin-4-ol (PubChem CID 137450894) has the molecular formula C5H11NOS
and a molecular weight of 133.22 g/mol. Its IUPAC name is 4-sulfanylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-sulfanylpiperidin-4-ol |
| PubChem CID | 137450894 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 4-sulfanylpiperidin-4-ol |
| SMILES | OC1(S)CCNCC1 |
| InChI | InChI=1S/C5H11NOS/c7-5(8)1-3-6-4-2-5/h6-8H,1-4H2 |
| InChIKey | DLBWJNXABCYERF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylpiperidin-4-ol?
The IUPAC name of 4-sulfanylpiperidin-4-ol (CID 137450894) is 4-sulfanylpiperidin-4-ol.
What is the SMILES notation for 4-sulfanylpiperidin-4-ol?
The canonical SMILES for 4-sulfanylpiperidin-4-ol is OC1(S)CCNCC1.
What is the InChIKey of 4-sulfanylpiperidin-4-ol?
The InChIKey is DLBWJNXABCYERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NOS/c7-5(8)1-3-6-4-2-5/h6-8H,1-4H2.
What are the key properties of 4-sulfanylpiperidin-4-ol?
4-sulfanylpiperidin-4-ol has a molecular weight of 133.22 g/mol, XLogP of -0.01, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylpiperidin-4-ol is sourced from PubChem (CID 137450894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).