About 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one
3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one (PubChem CID 137450914) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one.
Molecular Properties
| Compound Name | 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one |
| PubChem CID | 137450914 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one |
| SMILES | Nc1cccn([C@@H]2CCC[C@@H]2O)c1=O |
| InChI | InChI=1S/C10H14N2O2/c11-7-3-2-6-12(10(7)14)8-4-1-5-9(8)13/h2-3,6,8-9,13H,1,4-5,11H2/t8-,9+/m1/s1 |
| InChIKey | PHTBHHJIDZYIHB-BDAKNGLRSA-N |
| XLogP | 0.52 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one?
The IUPAC name of 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one (CID 137450914) is 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one.
What is the SMILES notation for 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one?
The canonical SMILES for 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one is Nc1cccn([C@@H]2CCC[C@@H]2O)c1=O.
What is the InChIKey of 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one?
The InChIKey is PHTBHHJIDZYIHB-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H14N2O2/c11-7-3-2-6-12(10(7)14)8-4-1-5-9(8)13/h2-3,6,8-9,13H,1,4-5,11H2/t8-,9+/m1/s1.
What are the key properties of 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one?
3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one has a molecular weight of 194.23 g/mol, XLogP of 0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[(1R,2S)-2-hydroxycyclopentyl]pyridin-2-one is sourced from PubChem (CID 137450914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).