C18H24N2O6S — CID 137451137
1,2,3-trimethoxy-5-[2-[4-methoxy-3-(sulfamoylamino)phenyl]ethyl]benzene (PubChem CID 137451137) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[2-[4-methoxy-3-(sulfamoylamino)phenyl]ethyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[2-[4-methoxy-3-(sulfamoylamino)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 137451137 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1,2,3-trimethoxy-5-[2-[4-methoxy-3-(sulfamoylamino)phenyl]ethyl]benzene |
| SMILES | COc1ccc(CCc2cc(OC)c(OC)c(OC)c2)cc1NS(N)(=O)=O |
| InChI | InChI=1S/C18H24N2O6S/c1-23-15-8-7-12(9-14(15)20-27(19,21)22)5-6-13-10-16(24-2)18(26-4)17(11-13)25-3/h7-11,20H,5-6H2,1-4H3,(H2,19,21,22) |
| InChIKey | YJBIZBPPJHRLJA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |