C12H17F — CID 137451315
(3E,5E,6Z)-5-(2-fluoroethylidene)-2-methylnona-1,3,6-triene (PubChem CID 137451315) has the molecular formula C12H17F and a molecular weight of 180.27 g/mol. Its IUPAC name is (3E,5E,6Z)-5-(2-fluoroethylidene)-2-methylnona-1,3,6-triene.
| Compound Name | (3E,5E,6Z)-5-(2-fluoroethylidene)-2-methylnona-1,3,6-triene |
|---|---|
| PubChem CID | 137451315 |
| Molecular Formula | C12H17F |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (3E,5E,6Z)-5-(2-fluoroethylidene)-2-methylnona-1,3,6-triene |
| SMILES | C=C(C)/C=C/C(/C=C\CC)=C/CF |
| InChI | InChI=1S/C12H17F/c1-4-5-6-12(9-10-13)8-7-11(2)3/h5-9H,2,4,10H2,1,3H3/b6-5-,8-7+,12-9+ |
| InChIKey | CCJRAIMQNPCTJP-PDLINSQHSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|