C17H22F11NO2 — CID 137452179
1-[1,1,1,3,3-pentafluoro-3-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]propan-2-yl]azepane (PubChem CID 137452179) has the molecular formula C17H22F11NO2 and a molecular weight of 481.35 g/mol. Its IUPAC name is 1-[1,1,1,3,3-pentafluoro-3-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]propan-2-yl]azepane.
| Compound Name | 1-[1,1,1,3,3-pentafluoro-3-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]propan-2-yl]azepane |
|---|---|
| PubChem CID | 137452179 |
| Molecular Formula | C17H22F11NO2 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 1-[1,1,1,3,3-pentafluoro-3-[5-(2,2,3,4,4,4-hexafluorobutyl)-1,4-dioxan-2-yl]propan-2-yl]azepane |
| SMILES | FC(C(F)(F)F)C(F)(F)CC1COC(C(F)(F)C(N2CCCCCC2)C(F)(F)F)CO1 |
| InChI | InChI=1S/C17H22F11NO2/c18-12(16(23,24)25)14(19,20)7-10-8-31-11(9-30-10)15(21,22)13(17(26,27)28)29-5-3-1-2-4-6-29/h10-13H,1-9H2 |
| InChIKey | BDVGRFPAWNXCGD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |