C12H10N2O4 — CID 137452198
5,7-dihydroxy-2,6-dimethylpyrrolo[3,4-f]isoindole-1,3-dione (PubChem CID 137452198) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 5,7-dihydroxy-2,6-dimethylpyrrolo[3,4-f]isoindole-1,3-dione.
| Compound Name | 5,7-dihydroxy-2,6-dimethylpyrrolo[3,4-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137452198 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5,7-dihydroxy-2,6-dimethylpyrrolo[3,4-f]isoindole-1,3-dione |
| SMILES | CN1C(=O)c2cc3c(O)n(C)c(O)c3cc2C1=O |
| InChI | InChI=1S/C12H10N2O4/c1-13-9(15)5-3-7-8(4-6(5)10(13)16)12(18)14(2)11(7)17/h3-4,15-16H,1-2H3 |
| InChIKey | JZRQDJOGELLNNW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|