About 2-ethyl-4-methylfuro[2,3-d]pyrimidine
2-ethyl-4-methylfuro[2,3-d]pyrimidine (PubChem CID 137452302) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-ethyl-4-methylfuro[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-ethyl-4-methylfuro[2,3-d]pyrimidine |
| PubChem CID | 137452302 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-ethyl-4-methylfuro[2,3-d]pyrimidine |
| SMILES | CCc1nc(C)c2ccoc2n1 |
| InChI | InChI=1S/C9H10N2O/c1-3-8-10-6(2)7-4-5-12-9(7)11-8/h4-5H,3H2,1-2H3 |
| InChIKey | BUTNZTOEAHWWJX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4-methylfuro[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methylfuro[2,3-d]pyrimidine?
The IUPAC name of 2-ethyl-4-methylfuro[2,3-d]pyrimidine (CID 137452302) is 2-ethyl-4-methylfuro[2,3-d]pyrimidine.
What is the SMILES notation for 2-ethyl-4-methylfuro[2,3-d]pyrimidine?
The canonical SMILES for 2-ethyl-4-methylfuro[2,3-d]pyrimidine is CCc1nc(C)c2ccoc2n1.
What is the InChIKey of 2-ethyl-4-methylfuro[2,3-d]pyrimidine?
The InChIKey is BUTNZTOEAHWWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-3-8-10-6(2)7-4-5-12-9(7)11-8/h4-5H,3H2,1-2H3.
What are the key properties of 2-ethyl-4-methylfuro[2,3-d]pyrimidine?
2-ethyl-4-methylfuro[2,3-d]pyrimidine has a molecular weight of 162.19 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methylfuro[2,3-d]pyrimidine is sourced from PubChem (CID 137452302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).