C17H29N3O5S — CID 137452561
S-tert-butyl (6S)-6-[[(2R)-2-acetamido-4-amino-4-oxobutanoyl]amino]-3-oxoheptanethioate (PubChem CID 137452561) has the molecular formula C17H29N3O5S and a molecular weight of 387.50 g/mol. Its IUPAC name is S-tert-butyl (6S)-6-[[(2R)-2-acetamido-4-amino-4-oxobutanoyl]amino]-3-oxoheptanethioate.
| Compound Name | S-tert-butyl (6S)-6-[[(2R)-2-acetamido-4-amino-4-oxobutanoyl]amino]-3-oxoheptanethioate |
|---|---|
| PubChem CID | 137452561 |
| Molecular Formula | C17H29N3O5S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | S-tert-butyl (6S)-6-[[(2R)-2-acetamido-4-amino-4-oxobutanoyl]amino]-3-oxoheptanethioate |
| SMILES | CC(=O)N[C@H](CC(N)=O)C(=O)N[C@@H](C)CCC(=O)CC(=O)SC(C)(C)C |
| InChI | InChI=1S/C17H29N3O5S/c1-10(6-7-12(22)8-15(24)26-17(3,4)5)19-16(25)13(9-14(18)23)20-11(2)21/h10,13H,6-9H2,1-5H3,(H2,18,23)(H,19,25)(H,20,21)/t10-,13+/m0/s1 |
| InChIKey | ALXVEPFVSNCFQX-GXFFZTMASA-N |
| XLogP | 0.67 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|