C18H18F3N5O3 — CID 137452692
1-N-(3-methyloxetan-3-yl)-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide (PubChem CID 137452692) has the molecular formula C18H18F3N5O3 and a molecular weight of 409.37 g/mol. Its IUPAC name is 1-N-(3-methyloxetan-3-yl)-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide.
| Compound Name | 1-N-(3-methyloxetan-3-yl)-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
|---|---|
| PubChem CID | 137452692 |
| Molecular Formula | C18H18F3N5O3 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-N-(3-methyloxetan-3-yl)-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
| SMILES | CC1(NC(=O)c2ncn3c2CN(C(=O)Nc2cc(F)c(F)c(F)c2)CC3)COC1 |
| InChI | InChI=1S/C18H18F3N5O3/c1-18(7-29-8-18)24-16(27)15-13-6-25(2-3-26(13)9-22-15)17(28)23-10-4-11(19)14(21)12(20)5-10/h4-5,9H,2-3,6-8H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | SZDDYSUULLKXDH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|