C18H20F3N5O2 — CID 137452700
1-N-[(2R)-butan-2-yl]-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide (PubChem CID 137452700) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-N-[(2R)-butan-2-yl]-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide.
| Compound Name | 1-N-[(2R)-butan-2-yl]-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
|---|---|
| PubChem CID | 137452700 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-N-[(2R)-butan-2-yl]-7-N-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1ncn2c1CN(C(=O)Nc1cc(F)c(F)c(F)c1)CC2 |
| InChI | InChI=1S/C18H20F3N5O2/c1-3-10(2)23-17(27)16-14-8-25(4-5-26(14)9-22-16)18(28)24-11-6-12(19)15(21)13(20)7-11/h6-7,9-10H,3-5,8H2,1-2H3,(H,23,27)(H,24,28)/t10-/m1/s1 |
| InChIKey | IRSASFUVASNTNX-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|