C18H18F5N5O2 — CID 137452756
(6S)-7-N-(3,4-difluorophenyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide (PubChem CID 137452756) has the molecular formula C18H18F5N5O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is (6S)-7-N-(3,4-difluorophenyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide.
| Compound Name | (6S)-7-N-(3,4-difluorophenyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
|---|---|
| PubChem CID | 137452756 |
| Molecular Formula | C18H18F5N5O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (6S)-7-N-(3,4-difluorophenyl)-6-methyl-1-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1,7-dicarboxamide |
| SMILES | C[C@H]1Cn2cnc(C(=O)N[C@H](C)C(F)(F)F)c2CN1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F5N5O2/c1-9-6-27-8-24-15(16(29)25-10(2)18(21,22)23)14(27)7-28(9)17(30)26-11-3-4-12(19)13(20)5-11/h3-5,8-10H,6-7H2,1-2H3,(H,25,29)(H,26,30)/t9-,10+/m0/s1 |
| InChIKey | OYDRJZKKQDYCNI-VHSXEESVSA-N |
| XLogP | 3.28 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |