About 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide
2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 137453211) has the molecular formula C7H12N2O3S2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 137453211 |
| Molecular Formula | C7H12N2O3S2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1cnc(C(C)(C)O)s1 |
| InChI | InChI=1S/C7H12N2O3S2/c1-7(2,10)6-9-4-5(13-6)14(11,12)8-3/h4,8,10H,1-3H3 |
| InChIKey | ANRDUPRGOWSADX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide (CID 137453211) is 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide is CNS(=O)(=O)c1cnc(C(C)(C)O)s1.
What is the InChIKey of 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide?
The InChIKey is ANRDUPRGOWSADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S2/c1-7(2,10)6-9-4-5(13-6)14(11,12)8-3/h4,8,10H,1-3H3.
What are the key properties of 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide?
2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide has a molecular weight of 236.32 g/mol, XLogP of 0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxypropan-2-yl)-N-methyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 137453211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).