C18H15F4N3O2 — CID 137453696
4-fluoro-N-[(5-methoxy-3-methylbenzimidazol-4-yl)methyl]-3-(trifluoromethyl)benzamide (PubChem CID 137453696) has the molecular formula C18H15F4N3O2 and a molecular weight of 381.33 g/mol. Its IUPAC name is 4-fluoro-N-[(5-methoxy-3-methylbenzimidazol-4-yl)methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-[(5-methoxy-3-methylbenzimidazol-4-yl)methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137453696 |
| Molecular Formula | C18H15F4N3O2 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-fluoro-N-[(5-methoxy-3-methylbenzimidazol-4-yl)methyl]-3-(trifluoromethyl)benzamide |
| SMILES | COc1ccc2ncn(C)c2c1CNC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F4N3O2/c1-25-9-24-14-5-6-15(27-2)11(16(14)25)8-23-17(26)10-3-4-13(19)12(7-10)18(20,21)22/h3-7,9H,8H2,1-2H3,(H,23,26) |
| InChIKey | VGTMDYHJNKBRBX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |