C14H10BrF3N2 — CID 137453774
4-bromo-2-[(3,5-difluorophenyl)methyliminomethyl]-3-fluoroaniline (PubChem CID 137453774) has the molecular formula C14H10BrF3N2 and a molecular weight of 343.15 g/mol. Its IUPAC name is 4-bromo-2-[(3,5-difluorophenyl)methyliminomethyl]-3-fluoroaniline.
| Compound Name | 4-bromo-2-[(3,5-difluorophenyl)methyliminomethyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 137453774 |
| Molecular Formula | C14H10BrF3N2 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 4-bromo-2-[(3,5-difluorophenyl)methyliminomethyl]-3-fluoroaniline |
| SMILES | Nc1ccc(Br)c(F)c1/C=N/Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H10BrF3N2/c15-12-1-2-13(19)11(14(12)18)7-20-6-8-3-9(16)5-10(17)4-8/h1-5,7H,6,19H2/b20-7+ |
| InChIKey | QCAUFIKCTNUERB-IFRROFPPSA-N |
| XLogP | 4.07 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|