C18H15FN4O5 — CID 137453961
2-[6-(1,3-dioxo-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazin-2-yl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-4-yl]acetonitrile (PubChem CID 137453961) has the molecular formula C18H15FN4O5 and a molecular weight of 386.34 g/mol. Its IUPAC name is 2-[6-(1,3-dioxo-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazin-2-yl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-4-yl]acetonitrile.
| Compound Name | 2-[6-(1,3-dioxo-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazin-2-yl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-4-yl]acetonitrile |
|---|---|
| PubChem CID | 137453961 |
| Molecular Formula | C18H15FN4O5 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[6-(1,3-dioxo-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]oxazin-2-yl)-7-fluoro-3-oxospiro[1,4-benzoxazine-2,1'-cyclopropane]-4-yl]acetonitrile |
| SMILES | N#CCN1C(=O)C2(CC2)Oc2cc(F)c(N3C(=O)C4COCCN4C3=O)cc21 |
| InChI | InChI=1S/C18H15FN4O5/c19-10-7-14-12(21(4-3-20)16(25)18(28-14)1-2-18)8-11(10)23-15(24)13-9-27-6-5-22(13)17(23)26/h7-8,13H,1-2,4-6,9H2 |
| InChIKey | VYVMWHMVBKAZMA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 103.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|