C25H25N3O — CID 137454333
2,7-dimethyl-8-[(11S)-11-methyl-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-trien-10-yl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 137454333) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 2,7-dimethyl-8-[(11S)-11-methyl-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-trien-10-yl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2,7-dimethyl-8-[(11S)-11-methyl-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-trien-10-yl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 137454333 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2,7-dimethyl-8-[(11S)-11-methyl-1,10-diazatricyclo[7.2.2.02,7]trideca-2,4,6-trien-10-yl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(N3C4CCN(c5ccccc5C4)[C@@H]3C)c(C)ccc12 |
| InChI | InChI=1S/C25H25N3O/c1-15-8-10-20-21-11-9-16(2)26-25(21)29-24(20)23(15)28-17(3)27-13-12-19(28)14-18-6-4-5-7-22(18)27/h4-11,17,19H,12-14H2,1-3H3/t17-,19?/m0/s1 |
| InChIKey | HDBYGVKSSDWUBC-KKFHFHRHSA-N |
| XLogP | 5.59 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |