About (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane
(2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane (PubChem CID 137454503) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane |
| PubChem CID | 137454503 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane |
| SMILES | Cc1cc(C)c(C)c(C2C3CCN(C3)[C@@H]2C)c1 |
| InChI | InChI=1S/C16H23N/c1-10-7-11(2)12(3)15(8-10)16-13(4)17-6-5-14(16)9-17/h7-8,13-14,16H,5-6,9H2,1-4H3/t13-,14?,16?/m1/s1 |
| InChIKey | XCQIVVSVECBASS-VQCLRJIVSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane?
The IUPAC name of (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane (CID 137454503) is (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane.
What is the SMILES notation for (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane?
The canonical SMILES for (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane is Cc1cc(C)c(C)c(C2C3CCN(C3)[C@@H]2C)c1.
What is the InChIKey of (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane?
The InChIKey is XCQIVVSVECBASS-VQCLRJIVSA-N. The full InChI is InChI=1S/C16H23N/c1-10-7-11(2)12(3)15(8-10)16-13(4)17-6-5-14(16)9-17/h7-8,13-14,16H,5-6,9H2,1-4H3/t13-,14?,16?/m1/s1.
What are the key properties of (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane?
(2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane has a molecular weight of 229.37 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-3-(2,3,5-trimethylphenyl)-1-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 137454503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).