C20H31N — CID 137454646
(3S)-1,3,4,5,6-pentamethyl-2-(2,3,5-trimethylphenyl)-2-azabicyclo[2.2.1]heptane (PubChem CID 137454646) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is (3S)-1,3,4,5,6-pentamethyl-2-(2,3,5-trimethylphenyl)-2-azabicyclo[2.2.1]heptane.
| Compound Name | (3S)-1,3,4,5,6-pentamethyl-2-(2,3,5-trimethylphenyl)-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 137454646 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (3S)-1,3,4,5,6-pentamethyl-2-(2,3,5-trimethylphenyl)-2-azabicyclo[2.2.1]heptane |
| SMILES | Cc1cc(C)c(C)c(N2[C@@H](C)C3(C)CC2(C)C(C)C3C)c1 |
| InChI | InChI=1S/C20H31N/c1-12-9-13(2)14(3)18(10-12)21-17(6)19(7)11-20(21,8)16(5)15(19)4/h9-10,15-17H,11H2,1-8H3/t15?,16?,17-,19?,20?/m0/s1 |
| InChIKey | WXXVVPRNKNGZQF-XRFGPQKQSA-N |
| XLogP | 5.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |