About (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane
(4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane (PubChem CID 137454780) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane |
| PubChem CID | 137454780 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane |
| SMILES | C[C@H]1N2CC3CN(C2)CC1(c1cccn1C)C3 |
| InChI | InChI=1S/C14H21N3/c1-11-14(13-4-3-5-15(13)2)6-12-7-16(9-14)10-17(11)8-12/h3-5,11-12H,6-10H2,1-2H3/t11-,12?,14?/m1/s1 |
| InChIKey | DAOCBQROOKMWIR-LKSINWNRSA-N |
| XLogP | 1.26 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane?
The IUPAC name of (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane (CID 137454780) is (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane?
The canonical SMILES for (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane is C[C@H]1N2CC3CN(C2)CC1(c1cccn1C)C3.
What is the InChIKey of (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane?
The InChIKey is DAOCBQROOKMWIR-LKSINWNRSA-N. The full InChI is InChI=1S/C14H21N3/c1-11-14(13-4-3-5-15(13)2)6-12-7-16(9-14)10-17(11)8-12/h3-5,11-12H,6-10H2,1-2H3/t11-,12?,14?/m1/s1.
What are the key properties of (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane?
(4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane has a molecular weight of 231.34 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-methyl-5-(1-methylpyrrol-2-yl)-1,3-diazatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 137454780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).