C18H31NO2 — CID 137457045
2-(9-amino-10-methyl-2,3,6-trimethylideneundec-10-enyl)propane-1,3-diol (PubChem CID 137457045) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-(9-amino-10-methyl-2,3,6-trimethylideneundec-10-enyl)propane-1,3-diol.
| Compound Name | 2-(9-amino-10-methyl-2,3,6-trimethylideneundec-10-enyl)propane-1,3-diol |
|---|---|
| PubChem CID | 137457045 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 2-(9-amino-10-methyl-2,3,6-trimethylideneundec-10-enyl)propane-1,3-diol |
| SMILES | C=C(CCC(=C)C(=C)CC(CO)CO)CCC(N)C(=C)C |
| InChI | InChI=1S/C18H31NO2/c1-13(2)18(19)9-7-14(3)6-8-15(4)16(5)10-17(11-20)12-21/h17-18,20-21H,1,3-12,19H2,2H3 |
| InChIKey | WKPUVWRTQDTNAO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|