C64H45F3N2O2 — CID 137457137
(Z)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-6,6,6-trifluoro-5-hydroxyhex-4-en-3-one (PubChem CID 137457137) has the molecular formula C64H45F3N2O2 and a molecular weight of 931.07 g/mol. Its IUPAC name is (Z)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-6,6,6-trifluoro-5-hydroxyhex-4-en-3-one.
| Compound Name | (Z)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-6,6,6-trifluoro-5-hydroxyhex-4-en-3-one |
|---|---|
| PubChem CID | 137457137 |
| Molecular Formula | C64H45F3N2O2 |
| Molecular Weight | 931.07 g/mol |
| Exact Mass | 930.34 |
| IUPAC Name | (Z)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-6,6,6-trifluoro-5-hydroxyhex-4-en-3-one |
| SMILES | O=C(/C=C(\O)C(F)(F)F)CCc1ccccc1-c1cc(-c2ccccc2-c2cnc(-c3ccccc3)cc2-c2ccccc2)cc(-c2ccccc2-c2cnc(-c3ccccc3)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C64H45F3N2O2/c65-64(66,67)63(71)38-51(70)34-33-45-23-13-14-28-52(45)48-35-49(53-29-15-17-31-55(53)59-41-68-61(46-24-9-3-10-25-46)39-57(59)43-19-5-1-6-20-43)37-50(36-48)54-30-16-18-32-56(54)60-42-69-62(47-26-11-4-12-27-47)40-58(60)44-21-7-2-8-22-44/h1-32,35-42,71H,33-34H2/b63-38- |
| InChIKey | YQNULRQKIZJVML-ZJUGCIOXSA-N |
| XLogP | 16.99 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.07 |
| LogP ≤ 5 | 16.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|