C64H47FN2O2 — CID 137457138
(E)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-4-fluoro-5-hydroxyhex-4-en-3-one (PubChem CID 137457138) has the molecular formula C64H47FN2O2 and a molecular weight of 895.09 g/mol. Its IUPAC name is (E)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-4-fluoro-5-hydroxyhex-4-en-3-one.
| Compound Name | (E)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-4-fluoro-5-hydroxyhex-4-en-3-one |
|---|---|
| PubChem CID | 137457138 |
| Molecular Formula | C64H47FN2O2 |
| Molecular Weight | 895.09 g/mol |
| Exact Mass | 894.36 |
| IUPAC Name | (E)-1-[2-[3,5-bis[2-(4,6-diphenyl-3-pyridinyl)phenyl]phenyl]phenyl]-4-fluoro-5-hydroxyhex-4-en-3-one |
| SMILES | C/C(O)=C(\F)C(=O)CCc1ccccc1-c1cc(-c2ccccc2-c2cnc(-c3ccccc3)cc2-c2ccccc2)cc(-c2ccccc2-c2cnc(-c3ccccc3)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C64H47FN2O2/c1-43(68)64(65)63(69)35-34-46-24-14-15-29-52(46)49-36-50(53-30-16-18-32-55(53)59-41-66-61(47-25-10-4-11-26-47)39-57(59)44-20-6-2-7-21-44)38-51(37-49)54-31-17-19-33-56(54)60-42-67-62(48-27-12-5-13-28-48)40-58(60)45-22-8-3-9-23-45/h2-33,36-42,68H,34-35H2,1H3/b64-43+ |
| InChIKey | ZKCRCYLLQDFBHB-RSGMVYIYSA-N |
| XLogP | 16.74 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.09 |
| LogP ≤ 5 | 16.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|