C24H37ClN4O3 — CID 137457172
N-[[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methyl]-3,3-dimethylbutanamide (PubChem CID 137457172) has the molecular formula C24H37ClN4O3 and a molecular weight of 465.04 g/mol. Its IUPAC name is N-[[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methyl]-3,3-dimethylbutanamide.
| Compound Name | N-[[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 137457172 |
| Molecular Formula | C24H37ClN4O3 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[[1-[[2-chloro-5-(3,3-diethoxyprop-1-ynyl)pyrimidin-4-yl]amino]cyclohexyl]methyl]-3,3-dimethylbutanamide |
| SMILES | CCOC(C#Cc1cnc(Cl)nc1NC1(CNC(=O)CC(C)(C)C)CCCCC1)OCC |
| InChI | InChI=1S/C24H37ClN4O3/c1-6-31-20(32-7-2)12-11-18-16-26-22(25)28-21(18)29-24(13-9-8-10-14-24)17-27-19(30)15-23(3,4)5/h16,20H,6-10,13-15,17H2,1-5H3,(H,27,30)(H,26,28,29) |
| InChIKey | BFFXOPDVYUDBLL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|