About 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine
2-butyl-6-ethyl-3,4-dihydropyridin-3-amine (PubChem CID 137457218) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine |
| PubChem CID | 137457218 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine |
| SMILES | CCCCC1=NC(CC)=CCC1N |
| InChI | InChI=1S/C11H20N2/c1-3-5-6-11-10(12)8-7-9(4-2)13-11/h7,10H,3-6,8,12H2,1-2H3 |
| InChIKey | SSEWOCSKPRIEPT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine?
The IUPAC name of 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine (CID 137457218) is 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine.
What is the SMILES notation for 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine?
The canonical SMILES for 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine is CCCCC1=NC(CC)=CCC1N.
What is the InChIKey of 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine?
The InChIKey is SSEWOCSKPRIEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-3-5-6-11-10(12)8-7-9(4-2)13-11/h7,10H,3-6,8,12H2,1-2H3.
What are the key properties of 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine?
2-butyl-6-ethyl-3,4-dihydropyridin-3-amine has a molecular weight of 180.29 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-ethyl-3,4-dihydropyridin-3-amine is sourced from PubChem (CID 137457218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).