About tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate
tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 137457514) has the molecular formula C17H26N2O4
and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate |
| PubChem CID | 137457514 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | CO[C@@H]1CCCC[C@@H]1n1cccc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)23-16(21)18-12-8-7-11-19(15(12)20)13-9-5-6-10-14(13)22-4/h7-8,11,13-14H,5-6,9-10H2,1-4H3,(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | LECWXUYBCZSVED-UONOGXRCSA-N |
| XLogP | 3.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate?
The IUPAC name of tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate (CID 137457514) is tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate.
What is the SMILES notation for tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate?
The canonical SMILES for tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate is CO[C@@H]1CCCC[C@@H]1n1cccc(NC(=O)OC(C)(C)C)c1=O.
What is the InChIKey of tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate?
The InChIKey is LECWXUYBCZSVED-UONOGXRCSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-17(2,3)23-16(21)18-12-8-7-11-19(15(12)20)13-9-5-6-10-14(13)22-4/h7-8,11,13-14H,5-6,9-10H2,1-4H3,(H,18,21)/t13-,14+/m0/s1.
What are the key properties of tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate?
tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate has a molecular weight of 322.41 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-[(1S,2R)-2-methoxycyclohexyl]-2-oxo-3-pyridinyl]carbamate is sourced from PubChem (CID 137457514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).