About 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid
1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid (PubChem CID 137457643) has the molecular formula C9H8FNO3
and a molecular weight of 197.16 g/mol. Its IUPAC name is 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid |
| PubChem CID | 137457643 |
| Molecular Formula | C9H8FNO3 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccn([C@@H]2C[C@H]2F)c1=O |
| InChI | InChI=1S/C9H8FNO3/c10-6-4-7(6)11-3-1-2-5(8(11)12)9(13)14/h1-3,6-7H,4H2,(H,13,14)/t6-,7-/m1/s1 |
| InChIKey | ZMNOPMYWELKLAX-RNFRBKRXSA-N |
| XLogP | 0.83 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid?
The IUPAC name of 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid (CID 137457643) is 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid.
What is the SMILES notation for 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid?
The canonical SMILES for 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid is O=C(O)c1cccn([C@@H]2C[C@H]2F)c1=O.
What is the InChIKey of 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid?
The InChIKey is ZMNOPMYWELKLAX-RNFRBKRXSA-N. The full InChI is InChI=1S/C9H8FNO3/c10-6-4-7(6)11-3-1-2-5(8(11)12)9(13)14/h1-3,6-7H,4H2,(H,13,14)/t6-,7-/m1/s1.
What are the key properties of 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid?
1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid has a molecular weight of 197.16 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-2-fluorocyclopropyl]-2-oxopyridine-3-carboxylic acid is sourced from PubChem (CID 137457643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).