C16H24N2O4 — CID 137457648
tert-butyl N-[1-[(1S,2R)-2-hydroxycyclohexyl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 137457648) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is tert-butyl N-[1-[(1S,2R)-2-hydroxycyclohexyl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[1-[(1S,2R)-2-hydroxycyclohexyl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 137457648 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | tert-butyl N-[1-[(1S,2R)-2-hydroxycyclohexyl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccn([C@H]2CCCC[C@H]2O)c1=O |
| InChI | InChI=1S/C16H24N2O4/c1-16(2,3)22-15(21)17-11-7-6-10-18(14(11)20)12-8-4-5-9-13(12)19/h6-7,10,12-13,19H,4-5,8-9H2,1-3H3,(H,17,21)/t12-,13+/m0/s1 |
| InChIKey | DEIHNXYXRFYRMQ-QWHCGFSZSA-N |
| XLogP | 2.67 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |