About 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one
1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one (PubChem CID 137457655) has the molecular formula C14H21F2N3O
and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one |
| PubChem CID | 137457655 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one |
| SMILES | CC(C)Nc1cccn([C@@H]2CCN(C)CC2(F)F)c1=O |
| InChI | InChI=1S/C14H21F2N3O/c1-10(2)17-11-5-4-7-19(13(11)20)12-6-8-18(3)9-14(12,15)16/h4-5,7,10,12,17H,6,8-9H2,1-3H3/t12-/m1/s1 |
| InChIKey | OXKGQOFNUDOHBE-GFCCVEGCSA-N |
| XLogP | 2.18 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
The IUPAC name of 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one (CID 137457655) is 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one.
What is the SMILES notation for 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
The canonical SMILES for 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one is CC(C)Nc1cccn([C@@H]2CCN(C)CC2(F)F)c1=O.
What is the InChIKey of 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
The InChIKey is OXKGQOFNUDOHBE-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H21F2N3O/c1-10(2)17-11-5-4-7-19(13(11)20)12-6-8-18(3)9-14(12,15)16/h4-5,7,10,12,17H,6,8-9H2,1-3H3/t12-/m1/s1.
What are the key properties of 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one has a molecular weight of 285.34 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-3-(propan-2-ylamino)pyridin-2-one is sourced from PubChem (CID 137457655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).