About 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one
1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one (PubChem CID 137457666) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one |
| PubChem CID | 137457666 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one |
| SMILES | CO[C@@H]1COCC[C@@H]1n1cccc(NC(C)C)c1=O |
| InChI | InChI=1S/C14H22N2O3/c1-10(2)15-11-5-4-7-16(14(11)17)12-6-8-19-9-13(12)18-3/h4-5,7,10,12-13,15H,6,8-9H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | NZJWQRKKJFSTBW-QWHCGFSZSA-N |
| XLogP | 1.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
The IUPAC name of 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one (CID 137457666) is 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one.
What is the SMILES notation for 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
The canonical SMILES for 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one is CO[C@@H]1COCC[C@@H]1n1cccc(NC(C)C)c1=O.
What is the InChIKey of 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
The InChIKey is NZJWQRKKJFSTBW-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-10(2)15-11-5-4-7-16(14(11)17)12-6-8-19-9-13(12)18-3/h4-5,7,10,12-13,15H,6,8-9H2,1-3H3/t12-,13+/m0/s1.
What are the key properties of 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one?
1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one has a molecular weight of 266.34 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-3-methoxyoxan-4-yl]-3-(propan-2-ylamino)pyridin-2-one is sourced from PubChem (CID 137457666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).