C7H12N2 — CID 137457702
5-propan-2-yl-1,6-dihydropyridazine (PubChem CID 137457702) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 5-propan-2-yl-1,6-dihydropyridazine.
| Compound Name | 5-propan-2-yl-1,6-dihydropyridazine |
|---|---|
| PubChem CID | 137457702 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 5-propan-2-yl-1,6-dihydropyridazine |
| SMILES | CC(C)C1=CC=NNC1 |
| InChI | InChI=1S/C7H12N2/c1-6(2)7-3-4-8-9-5-7/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | MKJYXHPRPOIRDL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |