C14H20N2O4 — CID 137457824
tert-butyl N-[1-[(2S)-2-methoxycyclopropyl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 137457824) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is tert-butyl N-[1-[(2S)-2-methoxycyclopropyl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[1-[(2S)-2-methoxycyclopropyl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 137457824 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | tert-butyl N-[1-[(2S)-2-methoxycyclopropyl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | CO[C@H]1CC1n1cccc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C14H20N2O4/c1-14(2,3)20-13(18)15-9-6-5-7-16(12(9)17)10-8-11(10)19-4/h5-7,10-11H,8H2,1-4H3,(H,15,18)/t10?,11-/m0/s1 |
| InChIKey | OKWWDAXLZUUNLY-DTIOYNMSSA-N |
| XLogP | 2.16 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |