C19H29N5O3 — CID 137457922
1-cyano-2-[3-[[(Z)-pent-2-en-2-yl]amino]propyl]-3-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 137457922) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-cyano-2-[3-[[(Z)-pent-2-en-2-yl]amino]propyl]-3-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 1-cyano-2-[3-[[(Z)-pent-2-en-2-yl]amino]propyl]-3-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 137457922 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-cyano-2-[3-[[(Z)-pent-2-en-2-yl]amino]propyl]-3-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | CC/C=C(/C)NCCC/N=C(\NC#N)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H29N5O3/c1-6-8-14(2)21-9-7-10-22-19(23-13-20)24-15-11-16(25-3)18(27-5)17(12-15)26-4/h8,11-12,21H,6-7,9-10H2,1-5H3,(H2,22,23,24)/b14-8- |
| InChIKey | WBMGVVSJYQIQRQ-ZSOIEALJSA-N |
| XLogP | 2.84 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|