About (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide
(2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide (PubChem CID 137457996) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide.
Molecular Properties
| Compound Name | (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide |
| PubChem CID | 137457996 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide |
| SMILES | C=C/C=C\C(=N\C=C\C)N(C)C |
| InChI | InChI=1S/C10H16N2/c1-5-7-8-10(12(3)4)11-9-6-2/h5-9H,1H2,2-4H3/b8-7-,9-6+,11-10- |
| InChIKey | VTQHNZLVUDLWDH-DFVACGMESA-N |
| XLogP | 2.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide?
The IUPAC name of (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide (CID 137457996) is (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide.
What is the SMILES notation for (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide?
The canonical SMILES for (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide is C=C/C=C\C(=N\C=C\C)N(C)C.
What is the InChIKey of (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide?
The InChIKey is VTQHNZLVUDLWDH-DFVACGMESA-N. The full InChI is InChI=1S/C10H16N2/c1-5-7-8-10(12(3)4)11-9-6-2/h5-9H,1H2,2-4H3/b8-7-,9-6+,11-10-.
What are the key properties of (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide?
(2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide has a molecular weight of 164.25 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N,N-dimethyl-N'-[(E)-prop-1-enyl]penta-2,4-dienimidamide is sourced from PubChem (CID 137457996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).