C12H17NS — CID 137458078
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole (PubChem CID 137458078) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 137458078 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole |
| SMILES | C=C/C=C\C1=C(C=C)SC(C(C)C)N1 |
| InChI | InChI=1S/C12H17NS/c1-5-7-8-10-11(6-2)14-12(13-10)9(3)4/h5-9,12-13H,1-2H2,3-4H3/b8-7- |
| InChIKey | MNVRCPPRSMTPRH-FPLPWBNLSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|