C15H11ClFIN2O2 — CID 137458119
7-chloro-5-(2-fluorophenyl)-3-hydroxy-1-iodo-4,5-dihydro-3H-1,4-benzodiazepin-2-one (PubChem CID 137458119) has the molecular formula C15H11ClFIN2O2 and a molecular weight of 432.62 g/mol. Its IUPAC name is 7-chloro-5-(2-fluorophenyl)-3-hydroxy-1-iodo-4,5-dihydro-3H-1,4-benzodiazepin-2-one.
| Compound Name | 7-chloro-5-(2-fluorophenyl)-3-hydroxy-1-iodo-4,5-dihydro-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 137458119 |
| Molecular Formula | C15H11ClFIN2O2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 7-chloro-5-(2-fluorophenyl)-3-hydroxy-1-iodo-4,5-dihydro-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1C(O)NC(c2ccccc2F)c2cc(Cl)ccc2N1I |
| InChI | InChI=1S/C15H11ClFIN2O2/c16-8-5-6-12-10(7-8)13(9-3-1-2-4-11(9)17)19-14(21)15(22)20(12)18/h1-7,13-14,19,21H |
| InChIKey | IUQALMSPCYDVEN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|