About (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite
(2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite (PubChem CID 137458160) has the molecular formula C8H3ClN2S2
and a molecular weight of 226.71 g/mol. Its IUPAC name is (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite.
Molecular Properties
| Compound Name | (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite |
| PubChem CID | 137458160 |
| Molecular Formula | C8H3ClN2S2 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 225.94 |
| IUPAC Name | (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite |
| SMILES | N#Cc1nc2ccc(SCl)cc2s1 |
| InChI | InChI=1S/C8H3ClN2S2/c9-13-5-1-2-6-7(3-5)12-8(4-10)11-6/h1-3H |
| InChIKey | AERGYZPUGPLMOX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite?
The IUPAC name of (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite (CID 137458160) is (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite.
What is the SMILES notation for (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite?
The canonical SMILES for (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite is N#Cc1nc2ccc(SCl)cc2s1.
What is the InChIKey of (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite?
The InChIKey is AERGYZPUGPLMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClN2S2/c9-13-5-1-2-6-7(3-5)12-8(4-10)11-6/h1-3H.
What are the key properties of (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite?
(2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite has a molecular weight of 226.71 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-1,3-benzothiazol-6-yl) thiohypochlorite is sourced from PubChem (CID 137458160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).