C19H15ClFN3 — CID 137458583
1-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]indole (PubChem CID 137458583) has the molecular formula C19H15ClFN3 and a molecular weight of 339.80 g/mol. Its IUPAC name is 1-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]indole.
| Compound Name | 1-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]indole |
|---|---|
| PubChem CID | 137458583 |
| Molecular Formula | C19H15ClFN3 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-[4-(2-chloro-4-fluorophenyl)-1,3-dimethylpyrazol-5-yl]indole |
| SMILES | Cc1nn(C)c(-n2ccc3ccccc32)c1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H15ClFN3/c1-12-18(15-8-7-14(21)11-16(15)20)19(23(2)22-12)24-10-9-13-5-3-4-6-17(13)24/h3-11H,1-2H3 |
| InChIKey | NGKOVYGIHUZFAT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |