C56H30N4O2S2 — CID 137458646
5-[7-[7-(1,3-benzothiazol-7-yl)phenanthren-2-yl]-1,3-benzothiazol-2-yl]-7-[5-(1,3-benzoxazol-7-yl)phenanthren-1-yl]-1,3-benzoxazole (PubChem CID 137458646) has the molecular formula C56H30N4O2S2 and a molecular weight of 855.02 g/mol. Its IUPAC name is 5-[7-[7-(1,3-benzothiazol-7-yl)phenanthren-2-yl]-1,3-benzothiazol-2-yl]-7-[5-(1,3-benzoxazol-7-yl)phenanthren-1-yl]-1,3-benzoxazole.
| Compound Name | 5-[7-[7-(1,3-benzothiazol-7-yl)phenanthren-2-yl]-1,3-benzothiazol-2-yl]-7-[5-(1,3-benzoxazol-7-yl)phenanthren-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 137458646 |
| Molecular Formula | C56H30N4O2S2 |
| Molecular Weight | 855.02 g/mol |
| Exact Mass | 854.18 |
| IUPAC Name | 5-[7-[7-(1,3-benzothiazol-7-yl)phenanthren-2-yl]-1,3-benzothiazol-2-yl]-7-[5-(1,3-benzoxazol-7-yl)phenanthren-1-yl]-1,3-benzoxazole |
| SMILES | c1cc(-c2cccc3ncoc23)c2c(c1)ccc1c(-c3cc(-c4nc5cccc(-c6ccc7c(ccc8cc(-c9cccc%10ncsc9%10)ccc87)c6)c5s4)cc4ncoc34)cccc12 |
| InChI | InChI=1S/C56H30N4O2S2/c1-6-31-18-23-42-41(9-2-11-43(42)51(31)44(10-1)45-12-5-13-47-52(45)61-28-57-47)46-26-36(27-50-53(46)62-29-58-50)56-60-49-15-4-8-40(55(49)64-56)35-20-22-38-33(25-35)17-16-32-24-34(19-21-37(32)38)39-7-3-14-48-54(39)63-30-59-48/h1-30H |
| InChIKey | FJGZUJGMQIWZJF-UHFFFAOYSA-N |
| XLogP | 16.14 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.02 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|